C19H35N3O5 — CID 159581675
tert-butyl N-[(6S)-6-amino-1-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxononylidene]carbamate (PubChem CID 159581675) has the molecular formula C19H35N3O5 and a molecular weight of 385.51 g/mol. Its IUPAC name is tert-butyl N-[(6S)-6-amino-1-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxononylidene]carbamate.
| Compound Name | tert-butyl N-[(6S)-6-amino-1-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxononylidene]carbamate |
|---|---|
| PubChem CID | 159581675 |
| Molecular Formula | C19H35N3O5 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | tert-butyl N-[(6S)-6-amino-1-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxononylidene]carbamate |
| SMILES | CCC(=O)[C@@H](N)CCCCC(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H35N3O5/c1-8-14(23)13(20)11-9-10-12-15(21-16(24)26-18(2,3)4)22-17(25)27-19(5,6)7/h13H,8-12,20H2,1-7H3,(H,21,22,24,25)/t13-/m0/s1 |
| InChIKey | NTJIZSUFEOZWTO-ZDUSSCGKSA-N |
| XLogP | 3.71 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|