C39H71N5O10 — CID 159581674
tert-butyl N-[(6S)-6-amino-1-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxononylidene]carbamate;tert-butyl N-[(6S)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxononylidene]carbamate (PubChem CID 159581674) has the molecular formula C39H71N5O10 and a molecular weight of 770.02 g/mol. Its IUPAC name is tert-butyl N-[(6S)-6-amino-1-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxononylidene]carbamate;tert-butyl N-[(6S)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxononylidene]carbamate.
| Compound Name | tert-butyl N-[(6S)-6-amino-1-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxononylidene]carbamate;tert-butyl N-[(6S)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxononylidene]carbamate |
|---|---|
| PubChem CID | 159581674 |
| Molecular Formula | C39H71N5O10 |
| Molecular Weight | 770.02 g/mol |
| Exact Mass | 769.52 |
| IUPAC Name | tert-butyl N-[(6S)-6-amino-1-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxononylidene]carbamate;tert-butyl N-[(6S)-6-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxononylidene]carbamate |
| SMILES | CCC(=O)[C@@H](C)CCCCC(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C.CCC(=O)[C@@H](N)CCCCC(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H36N2O5.C19H35N3O5/c1-9-15(23)14(2)12-10-11-13-16(21-17(24)26-19(3,4)5)22-18(25)27-20(6,7)8;1-8-14(23)13(20)11-9-10-12-15(21-16(24)26-18(2,3)4)22-17(25)27-19(5,6)7/h14H,9-13H2,1-8H3,(H,21,22,24,25);13H,8-12,20H2,1-7H3,(H,21,22,24,25)/t14-;13-/m00/s1 |
| InChIKey | MJCBRGSOLJCDHH-ALKXEWLGSA-N |
| XLogP | 8.73 |
| TPSA | 214.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.02 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|