C22H30N2O5 — CID 90998790
2-[[4-[(5-methyl-2-propan-2-yl-1,3-oxazol-4-yl)methoxy]phenyl]methyl]-3-(propoxyamino)but-2-enoic acid (PubChem CID 90998790) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-[[4-[(5-methyl-2-propan-2-yl-1,3-oxazol-4-yl)methoxy]phenyl]methyl]-3-(propoxyamino)but-2-enoic acid.
| Compound Name | 2-[[4-[(5-methyl-2-propan-2-yl-1,3-oxazol-4-yl)methoxy]phenyl]methyl]-3-(propoxyamino)but-2-enoic acid |
|---|---|
| PubChem CID | 90998790 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-[[4-[(5-methyl-2-propan-2-yl-1,3-oxazol-4-yl)methoxy]phenyl]methyl]-3-(propoxyamino)but-2-enoic acid |
| SMILES | CCCONC(C)=C(Cc1ccc(OCc2nc(C(C)C)oc2C)cc1)C(=O)O |
| InChI | InChI=1S/C22H30N2O5/c1-6-11-28-24-15(4)19(22(25)26)12-17-7-9-18(10-8-17)27-13-20-16(5)29-21(23-20)14(2)3/h7-10,14,24H,6,11-13H2,1-5H3,(H,25,26) |
| InChIKey | PXVVSTHMYHGILR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|