C20H25F2N5 — CID 90999259
4-[[2-[3-(2,5-difluorophenyl)propyl]-3-pyridinyl]methyl]piperazine-1-carboximidamide (PubChem CID 90999259) has the molecular formula C20H25F2N5 and a molecular weight of 373.45 g/mol. Its IUPAC name is 4-[[2-[3-(2,5-difluorophenyl)propyl]-3-pyridinyl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-[[2-[3-(2,5-difluorophenyl)propyl]-3-pyridinyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 90999259 |
| Molecular Formula | C20H25F2N5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 4-[[2-[3-(2,5-difluorophenyl)propyl]-3-pyridinyl]methyl]piperazine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCN(Cc2cccnc2CCCc2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C20H25F2N5/c21-17-6-7-18(22)15(13-17)3-1-5-19-16(4-2-8-25-19)14-26-9-11-27(12-10-26)20(23)24/h2,4,6-8,13H,1,3,5,9-12,14H2,(H3,23,24) |
| InChIKey | FMFTXMMPZQZCJT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|