C26H39N5S — CID 89061825
4-[[2-[(3,5-ditert-butylphenyl)methylsulfanyl]-3-pyridinyl]methyl]piperazine-1-carboximidamide (PubChem CID 89061825) has the molecular formula C26H39N5S and a molecular weight of 453.70 g/mol. Its IUPAC name is 4-[[2-[(3,5-ditert-butylphenyl)methylsulfanyl]-3-pyridinyl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-[[2-[(3,5-ditert-butylphenyl)methylsulfanyl]-3-pyridinyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 89061825 |
| Molecular Formula | C26H39N5S |
| Molecular Weight | 453.70 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | 4-[[2-[(3,5-ditert-butylphenyl)methylsulfanyl]-3-pyridinyl]methyl]piperazine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCN(Cc2cccnc2SCc2cc(C(C)(C)C)cc(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C26H39N5S/c1-25(2,3)21-14-19(15-22(16-21)26(4,5)6)18-32-23-20(8-7-9-29-23)17-30-10-12-31(13-11-30)24(27)28/h7-9,14-16H,10-13,17-18H2,1-6H3,(H3,27,28) |
| InChIKey | TWXUHRCWVNAGAN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 69.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.70 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|