C18H20O6S — CID 90999352
[2-[2-(4-hydroxyphenyl)-1,2-dimethoxyethenyl]-4-methoxyphenyl]methanesulfinic acid (PubChem CID 90999352) has the molecular formula C18H20O6S and a molecular weight of 364.42 g/mol. Its IUPAC name is [2-[2-(4-hydroxyphenyl)-1,2-dimethoxyethenyl]-4-methoxyphenyl]methanesulfinic acid.
| Compound Name | [2-[2-(4-hydroxyphenyl)-1,2-dimethoxyethenyl]-4-methoxyphenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 90999352 |
| Molecular Formula | C18H20O6S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | [2-[2-(4-hydroxyphenyl)-1,2-dimethoxyethenyl]-4-methoxyphenyl]methanesulfinic acid |
| SMILES | COC(=C(OC)c1cc(OC)ccc1CS(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H20O6S/c1-22-15-9-6-13(11-25(20)21)16(10-15)18(24-3)17(23-2)12-4-7-14(19)8-5-12/h4-10,19H,11H2,1-3H3,(H,20,21) |
| InChIKey | MQUYWKMTNFADAF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|