C13H17F3N2O2S — CID 91002735
1-[(3-methylsulfonylphenyl)methyl]-4-(trifluoromethyl)piperazine (PubChem CID 91002735) has the molecular formula C13H17F3N2O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is 1-[(3-methylsulfonylphenyl)methyl]-4-(trifluoromethyl)piperazine.
| Compound Name | 1-[(3-methylsulfonylphenyl)methyl]-4-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 91002735 |
| Molecular Formula | C13H17F3N2O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-[(3-methylsulfonylphenyl)methyl]-4-(trifluoromethyl)piperazine |
| SMILES | CS(=O)(=O)c1cccc(CN2CCN(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C13H17F3N2O2S/c1-21(19,20)12-4-2-3-11(9-12)10-17-5-7-18(8-6-17)13(14,15)16/h2-4,9H,5-8,10H2,1H3 |
| InChIKey | MTWZPQOSTCMKRW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|