C22H21NO4 — CID 91004722
(5R)-5-(2-phenylethyl)-3-[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]oxolane-2,4-dione (PubChem CID 91004722) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is (5R)-5-(2-phenylethyl)-3-[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]oxolane-2,4-dione.
| Compound Name | (5R)-5-(2-phenylethyl)-3-[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]oxolane-2,4-dione |
|---|---|
| PubChem CID | 91004722 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (5R)-5-(2-phenylethyl)-3-[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]oxolane-2,4-dione |
| SMILES | O=C1O[C@H](CCc2ccccc2)C(=O)C1C(=O)[C@@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C22H21NO4/c24-20(17-12-15-8-4-5-9-16(15)13-23-17)19-21(25)18(27-22(19)26)11-10-14-6-2-1-3-7-14/h1-9,17-19,23H,10-13H2/t17-,18+,19?/m0/s1 |
| InChIKey | RKVCKZUXGFKIQV-PAMZHZACSA-N |
| XLogP | 2.01 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|