C27H29NO6 — CID 90934838
tert-butyl (3S)-3-[(5R)-2,4-dioxo-5-(2-phenylethyl)oxolane-3-carbonyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 90934838) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(5R)-2,4-dioxo-5-(2-phenylethyl)oxolane-3-carbonyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(5R)-2,4-dioxo-5-(2-phenylethyl)oxolane-3-carbonyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 90934838 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | tert-butyl (3S)-3-[(5R)-2,4-dioxo-5-(2-phenylethyl)oxolane-3-carbonyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2ccccc2C[C@H]1C(=O)C1C(=O)O[C@H](CCc2ccccc2)C1=O |
| InChI | InChI=1S/C27H29NO6/c1-27(2,3)34-26(32)28-16-19-12-8-7-11-18(19)15-20(28)23(29)22-24(30)21(33-25(22)31)14-13-17-9-5-4-6-10-17/h4-12,20-22H,13-16H2,1-3H3/t20-,21+,22?/m0/s1 |
| InChIKey | UJOQJHXTWBTLNC-UGGDCYSXSA-N |
| XLogP | 3.66 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|