C24H28N2O6 — CID 90865904
3-[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]-5-(3-morpholin-4-ylpropyl)oxolane-2,4-dione (PubChem CID 90865904) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is 3-[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]-5-(3-morpholin-4-ylpropyl)oxolane-2,4-dione.
| Compound Name | 3-[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]-5-(3-morpholin-4-ylpropyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 90865904 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 3-[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]-5-(3-morpholin-4-ylpropyl)oxolane-2,4-dione |
| SMILES | CC(=O)N1C=Cc2ccccc2C1CC(=O)C1C(=O)OC(CCCN2CCOCC2)C1=O |
| InChI | InChI=1S/C24H28N2O6/c1-16(27)26-10-8-17-5-2-3-6-18(17)19(26)15-20(28)22-23(29)21(32-24(22)30)7-4-9-25-11-13-31-14-12-25/h2-3,5-6,8,10,19,21-22H,4,7,9,11-15H2,1H3 |
| InChIKey | RODKQBHPTUTBMF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|