C25H23NO5 — CID 91420211
3-[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]-5-(2-phenylethyl)oxolane-2,4-dione (PubChem CID 91420211) has the molecular formula C25H23NO5 and a molecular weight of 417.46 g/mol. Its IUPAC name is 3-[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]-5-(2-phenylethyl)oxolane-2,4-dione.
| Compound Name | 3-[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]-5-(2-phenylethyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 91420211 |
| Molecular Formula | C25H23NO5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 3-[2-(2-acetyl-1H-isoquinolin-1-yl)acetyl]-5-(2-phenylethyl)oxolane-2,4-dione |
| SMILES | CC(=O)N1C=Cc2ccccc2C1CC(=O)C1C(=O)OC(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C25H23NO5/c1-16(27)26-14-13-18-9-5-6-10-19(18)20(26)15-21(28)23-24(29)22(31-25(23)30)12-11-17-7-3-2-4-8-17/h2-10,13-14,20,22-23H,11-12,15H2,1H3 |
| InChIKey | KVTFYLDKRWKEBA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|