C21H25NO5 — CID 10317122
ethyl 2-[[(2S)-1-benzyl-5-oxopyrrolidin-2-yl]methyl]-4,6-dioxocyclohexane-1-carboxylate (PubChem CID 10317122) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is ethyl 2-[[(2S)-1-benzyl-5-oxopyrrolidin-2-yl]methyl]-4,6-dioxocyclohexane-1-carboxylate.
| Compound Name | ethyl 2-[[(2S)-1-benzyl-5-oxopyrrolidin-2-yl]methyl]-4,6-dioxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10317122 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | ethyl 2-[[(2S)-1-benzyl-5-oxopyrrolidin-2-yl]methyl]-4,6-dioxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)CC(=O)CC1C[C@@H]1CCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H25NO5/c1-2-27-21(26)20-15(11-17(23)12-18(20)24)10-16-8-9-19(25)22(16)13-14-6-4-3-5-7-14/h3-7,15-16,20H,2,8-13H2,1H3/t15?,16-,20?/m0/s1 |
| InChIKey | XOAWKZBKAPLUOU-NGEICVOHSA-N |
| XLogP | 2.30 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|