C18H18Cl3NO3 — CID 139038382
chloroform;(1R,12S,13R,17R)-12-ethyl-16-oxa-10-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,8-tetraene-11,15-dione (PubChem CID 139038382) has the molecular formula C18H18Cl3NO3 and a molecular weight of 402.71 g/mol. Its IUPAC name is chloroform;(1R,12S,13R,17R)-12-ethyl-16-oxa-10-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,8-tetraene-11,15-dione.
| Compound Name | chloroform;(1R,12S,13R,17R)-12-ethyl-16-oxa-10-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,8-tetraene-11,15-dione |
|---|---|
| PubChem CID | 139038382 |
| Molecular Formula | C18H18Cl3NO3 |
| Molecular Weight | 402.71 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | chloroform;(1R,12S,13R,17R)-12-ethyl-16-oxa-10-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,8-tetraene-11,15-dione |
| SMILES | CC[C@@H]1C(=O)N2C=Cc3ccccc3[C@@H]2[C@@H]2OC(=O)C[C@@H]21.ClC(Cl)Cl |
| InChI | InChI=1S/C17H17NO3.CHCl3/c1-2-11-13-9-14(19)21-16(13)15-12-6-4-3-5-10(12)7-8-18(15)17(11)20;2-1(3)4/h3-8,11,13,15-16H,2,9H2,1H3;1H/t11-,13+,15+,16+;/m0./s1 |
| InChIKey | UICHKVOTQCFFDL-BZFJWFACSA-N |
| XLogP | 4.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.71 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|