C17H17NO3 — CID 102482111
(1R,12S,13R,17R)-12-ethyl-16-oxa-10-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,8-tetraene-11,15-dione (PubChem CID 102482111) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (1R,12S,13R,17R)-12-ethyl-16-oxa-10-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,8-tetraene-11,15-dione.
| Compound Name | (1R,12S,13R,17R)-12-ethyl-16-oxa-10-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,8-tetraene-11,15-dione |
|---|---|
| PubChem CID | 102482111 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (1R,12S,13R,17R)-12-ethyl-16-oxa-10-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,8-tetraene-11,15-dione |
| SMILES | CC[C@@H]1C(=O)N2C=Cc3ccccc3[C@@H]2[C@@H]2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C17H17NO3/c1-2-11-13-9-14(19)21-16(13)15-12-6-4-3-5-10(12)7-8-18(15)17(11)20/h3-8,11,13,15-16H,2,9H2,1H3/t11-,13+,15+,16+/m0/s1 |
| InChIKey | XBFFPPJCVWUTCN-KSZJFAHPSA-N |
| XLogP | 2.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |