C17H21NO2 — CID 91732687
(1R,11S,12S,15S)-12,15-dimethyl-13-oxa-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6-trien-14-one (PubChem CID 91732687) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (1R,11S,12S,15S)-12,15-dimethyl-13-oxa-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6-trien-14-one.
| Compound Name | (1R,11S,12S,15S)-12,15-dimethyl-13-oxa-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6-trien-14-one |
|---|---|
| PubChem CID | 91732687 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (1R,11S,12S,15S)-12,15-dimethyl-13-oxa-10-azatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6-trien-14-one |
| SMILES | C[C@@H]1OC(=O)[C@@]2(C)CC[C@@H]3c4ccccc4CCN3[C@H]12 |
| InChI | InChI=1S/C17H21NO2/c1-11-15-17(2,16(19)20-11)9-7-14-13-6-4-3-5-12(13)8-10-18(14)15/h3-6,11,14-15H,7-10H2,1-2H3/t11-,14+,15+,17-/m0/s1 |
| InChIKey | SDZGJSXWMYPUNQ-OFSOMGBPSA-N |
| XLogP | 2.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |