C20H26FNO4 — CID 122203039
dipropan-2-yl 8-fluoro-2,3,5,10a-tetrahydro-1H-pyrrolo[1,2-b]isoquinoline-10,10-dicarboxylate (PubChem CID 122203039) has the molecular formula C20H26FNO4 and a molecular weight of 363.43 g/mol. Its IUPAC name is dipropan-2-yl 8-fluoro-2,3,5,10a-tetrahydro-1H-pyrrolo[1,2-b]isoquinoline-10,10-dicarboxylate.
| Compound Name | dipropan-2-yl 8-fluoro-2,3,5,10a-tetrahydro-1H-pyrrolo[1,2-b]isoquinoline-10,10-dicarboxylate |
|---|---|
| PubChem CID | 122203039 |
| Molecular Formula | C20H26FNO4 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | dipropan-2-yl 8-fluoro-2,3,5,10a-tetrahydro-1H-pyrrolo[1,2-b]isoquinoline-10,10-dicarboxylate |
| SMILES | CC(C)OC(=O)C1(C(=O)OC(C)C)c2cc(F)ccc2CN2CCCC21 |
| InChI | InChI=1S/C20H26FNO4/c1-12(2)25-18(23)20(19(24)26-13(3)4)16-10-15(21)8-7-14(16)11-22-9-5-6-17(20)22/h7-8,10,12-13,17H,5-6,9,11H2,1-4H3 |
| InChIKey | OGWSQBOYKUXJBI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|