C12H20 — CID 91004805
4-ethenyl-3-ethylocta-3,5-diene (PubChem CID 91004805) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 4-ethenyl-3-ethylocta-3,5-diene.
| Compound Name | 4-ethenyl-3-ethylocta-3,5-diene |
|---|---|
| PubChem CID | 91004805 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 4-ethenyl-3-ethylocta-3,5-diene |
| SMILES | C=CC(C=CCC)=C(CC)CC |
| InChI | InChI=1S/C12H20/c1-5-9-10-12(8-4)11(6-2)7-3/h8-10H,4-7H2,1-3H3 |
| InChIKey | PGAGPIIULAMYOQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|