C22H40 — CID 144696306
(2Z,5Z,7Z)-5-[(Z)-but-2-en-2-yl]-6-ethenyl-4-methylidenedeca-2,5,7-triene;ethane;methane (PubChem CID 144696306) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is (2Z,5Z,7Z)-5-[(Z)-but-2-en-2-yl]-6-ethenyl-4-methylidenedeca-2,5,7-triene;ethane;methane.
| Compound Name | (2Z,5Z,7Z)-5-[(Z)-but-2-en-2-yl]-6-ethenyl-4-methylidenedeca-2,5,7-triene;ethane;methane |
|---|---|
| PubChem CID | 144696306 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | (2Z,5Z,7Z)-5-[(Z)-but-2-en-2-yl]-6-ethenyl-4-methylidenedeca-2,5,7-triene;ethane;methane |
| SMILES | C.C=CC(/C=C\CC)=C(C(=C)/C=C\C)\C(C)=C/C.CC.CC |
| InChI | InChI=1S/C17H24.2C2H6.CH4/c1-7-11-13-16(10-4)17(14(5)9-3)15(6)12-8-2;2*1-2;/h8-13H,4,6-7H2,1-3,5H3;2*1-2H3;1H4/b12-8-,13-11-,14-9-,17-16-;;; |
| InChIKey | JHJXANFEDBCWBN-RBGNDGKJSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|