C9H10N2 — CID 91004944
5a,9a-dihydro-3H-1,4-benzodiazepine (PubChem CID 91004944) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 5a,9a-dihydro-3H-1,4-benzodiazepine.
| Compound Name | 5a,9a-dihydro-3H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 91004944 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 5a,9a-dihydro-3H-1,4-benzodiazepine |
| SMILES | C1=CC2C=NCC=NC2C=C1 |
| InChI | InChI=1S/C9H10N2/c1-2-4-9-8(3-1)7-10-5-6-11-9/h1-4,6-9H,5H2 |
| InChIKey | HDSXFHRNVPSYME-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |