C37H33N3O11 — CID 91005425
(3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 4-cyanobenzoate;4-isocyanobenzoic acid;[(3S)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-cyanobenzoate (PubChem CID 91005425) has the molecular formula C37H33N3O11 and a molecular weight of 695.68 g/mol. Its IUPAC name is (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 4-cyanobenzoate;4-isocyanobenzoic acid;[(3S)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-cyanobenzoate.
| Compound Name | (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 4-cyanobenzoate;4-isocyanobenzoic acid;[(3S)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 91005425 |
| Molecular Formula | C37H33N3O11 |
| Molecular Weight | 695.68 g/mol |
| Exact Mass | 695.21 |
| IUPAC Name | (3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl) 4-cyanobenzoate;4-isocyanobenzoic acid;[(3S)-3-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 4-cyanobenzoate |
| SMILES | C[C@H]1COC2C(OC(=O)c3ccc(C#N)cc3)COC21.N#Cc1ccc(C(=O)OC2COC3C(O)COC23)cc1.[C-]#[N+]c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H15NO4.C14H13NO5.C8H5NO2/c1-9-7-18-14-12(8-19-13(9)14)20-15(17)11-4-2-10(6-16)3-5-11;15-5-8-1-3-9(4-2-8)14(17)20-11-7-19-12-10(16)6-18-13(11)12;1-9-7-4-2-6(3-5-7)8(10)11/h2-5,9,12-14H,7-8H2,1H3;1-4,10-13,16H,6-7H2;2-5H,(H,10,11)/t9-,12?,13?,14?;;/m0../s1 |
| InChIKey | JDRXRJLJSDQVHS-AQDADSJVSA-N |
| XLogP | 3.70 |
| TPSA | 198.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.68 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|