C14H14NO5P — CID 20663401
(6-phosphanyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) 4-cyanobenzoate (PubChem CID 20663401) has the molecular formula C14H14NO5P and a molecular weight of 307.24 g/mol. Its IUPAC name is (6-phosphanyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) 4-cyanobenzoate.
| Compound Name | (6-phosphanyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) 4-cyanobenzoate |
|---|---|
| PubChem CID | 20663401 |
| Molecular Formula | C14H14NO5P |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | (6-phosphanyloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl) 4-cyanobenzoate |
| SMILES | N#Cc1ccc(C(=O)OC2COC3C(OP)COC23)cc1 |
| InChI | InChI=1S/C14H14NO5P/c15-5-8-1-3-9(4-2-8)14(16)19-10-6-17-13-11(20-21)7-18-12(10)13/h1-4,10-13H,6-7,21H2 |
| InChIKey | CUDUXVGHACQJTH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|