C27H30N2O4 — CID 91006520
2-[[4-[(3-benzhydryl-6-oxo-1H-pyridazin-4-yl)methyl]cyclohexyl]methoxy]acetic acid (PubChem CID 91006520) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is 2-[[4-[(3-benzhydryl-6-oxo-1H-pyridazin-4-yl)methyl]cyclohexyl]methoxy]acetic acid.
| Compound Name | 2-[[4-[(3-benzhydryl-6-oxo-1H-pyridazin-4-yl)methyl]cyclohexyl]methoxy]acetic acid |
|---|---|
| PubChem CID | 91006520 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 2-[[4-[(3-benzhydryl-6-oxo-1H-pyridazin-4-yl)methyl]cyclohexyl]methoxy]acetic acid |
| SMILES | O=C(O)COCC1CCC(Cc2cc(=O)[nH]nc2C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H30N2O4/c30-24-16-23(15-19-11-13-20(14-12-19)17-33-18-25(31)32)27(29-28-24)26(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-10,16,19-20,26H,11-15,17-18H2,(H,28,30)(H,31,32) |
| InChIKey | HCSVROXWDAOVEF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |