C50H54N6O6 — CID 158975082
2-[[4-[6-(N-phenylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid (PubChem CID 158975082) has the molecular formula C50H54N6O6 and a molecular weight of 835.02 g/mol. Its IUPAC name is 2-[[4-[6-(N-phenylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid.
| Compound Name | 2-[[4-[6-(N-phenylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid |
|---|---|
| PubChem CID | 158975082 |
| Molecular Formula | C50H54N6O6 |
| Molecular Weight | 835.02 g/mol |
| Exact Mass | 834.41 |
| IUPAC Name | 2-[[4-[6-(N-phenylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid |
| SMILES | O=C(O)COCC1CCC(c2cncc(N(c3ccccc3)c3ccccc3)n2)CC1.O=C(O)COCC1CCC(c2cncc(N(c3ccccc3)c3ccccc3)n2)CC1 |
| InChI | InChI=1S/2C25H27N3O3/c2*29-25(30)18-31-17-19-11-13-20(14-12-19)23-15-26-16-24(27-23)28(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h2*1-10,15-16,19-20H,11-14,17-18H2,(H,29,30) |
| InChIKey | JOHGULZNZQYLHM-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 151.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.02 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |