C27H29N3O3 — CID 139402195
ethyl 2-[[4-[6-(N-phenylanilino)pyrazin-2-yl]cyclohex-3-en-1-yl]methoxy]acetate (PubChem CID 139402195) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is ethyl 2-[[4-[6-(N-phenylanilino)pyrazin-2-yl]cyclohex-3-en-1-yl]methoxy]acetate.
| Compound Name | ethyl 2-[[4-[6-(N-phenylanilino)pyrazin-2-yl]cyclohex-3-en-1-yl]methoxy]acetate |
|---|---|
| PubChem CID | 139402195 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | ethyl 2-[[4-[6-(N-phenylanilino)pyrazin-2-yl]cyclohex-3-en-1-yl]methoxy]acetate |
| SMILES | CCOC(=O)COCC1CC=C(c2cncc(N(c3ccccc3)c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C27H29N3O3/c1-2-33-27(31)20-32-19-21-13-15-22(16-14-21)25-17-28-18-26(29-25)30(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-12,15,17-18,21H,2,13-14,16,19-20H2,1H3 |
| InChIKey | RYVNFHOVAFZPKG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |