C27H27N3O3S — CID 91007572
[4-(2-methylsulfanylphenyl)phenyl] N-[4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]butyl]carbamate (PubChem CID 91007572) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is [4-(2-methylsulfanylphenyl)phenyl] N-[4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]butyl]carbamate.
| Compound Name | [4-(2-methylsulfanylphenyl)phenyl] N-[4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 91007572 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | [4-(2-methylsulfanylphenyl)phenyl] N-[4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]butyl]carbamate |
| SMILES | CSc1ccccc1-c1ccc(OC(=O)NCCCCc2cccc(-c3noc(C)n3)c2)cc1 |
| InChI | InChI=1S/C27H27N3O3S/c1-19-29-26(30-33-19)22-10-7-9-20(18-22)8-5-6-17-28-27(31)32-23-15-13-21(14-16-23)24-11-3-4-12-25(24)34-2/h3-4,7,9-16,18H,5-6,8,17H2,1-2H3,(H,28,31) |
| InChIKey | YIFGSBIESJRINV-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|