C21H36N2O10 — CID 91008684
(2,5-dihydroxypyrrol-1-yl) 5-[3-[2,3-bis(2-methoxyethoxy)propoxy]propylamino]-5-oxopentanoate (PubChem CID 91008684) has the molecular formula C21H36N2O10 and a molecular weight of 476.52 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 5-[3-[2,3-bis(2-methoxyethoxy)propoxy]propylamino]-5-oxopentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 5-[3-[2,3-bis(2-methoxyethoxy)propoxy]propylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 91008684 |
| Molecular Formula | C21H36N2O10 |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 5-[3-[2,3-bis(2-methoxyethoxy)propoxy]propylamino]-5-oxopentanoate |
| SMILES | COCCOCC(COCCCNC(=O)CCCC(=O)On1c(O)ccc1O)OCCOC |
| InChI | InChI=1S/C21H36N2O10/c1-28-11-13-31-16-17(32-14-12-29-2)15-30-10-4-9-22-18(24)5-3-6-21(27)33-23-19(25)7-8-20(23)26/h7-8,17,25-26H,3-6,9-16H2,1-2H3,(H,22,24) |
| InChIKey | NOVYLCJYEHHSRJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|