C14H30O4 — CID 91010902
2-ethyl-6-(2-hydroxyethyl)-2,4-dimethyloctane-1,3,8-triol (PubChem CID 91010902) has the molecular formula C14H30O4 and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-ethyl-6-(2-hydroxyethyl)-2,4-dimethyloctane-1,3,8-triol.
| Compound Name | 2-ethyl-6-(2-hydroxyethyl)-2,4-dimethyloctane-1,3,8-triol |
|---|---|
| PubChem CID | 91010902 |
| Molecular Formula | C14H30O4 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 2-ethyl-6-(2-hydroxyethyl)-2,4-dimethyloctane-1,3,8-triol |
| SMILES | CCC(C)(CO)C(O)C(C)CC(CCO)CCO |
| InChI | InChI=1S/C14H30O4/c1-4-14(3,10-17)13(18)11(2)9-12(5-7-15)6-8-16/h11-13,15-18H,4-10H2,1-3H3 |
| InChIKey | XKRNOLGSYLPINB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |