C14H26O4Si — CID 91012153
(2S)-2-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxabicyclo[3.1.0]hexan-2-yl]propanoic acid (PubChem CID 91012153) has the molecular formula C14H26O4Si and a molecular weight of 286.44 g/mol. Its IUPAC name is (2S)-2-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxabicyclo[3.1.0]hexan-2-yl]propanoic acid.
| Compound Name | (2S)-2-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxabicyclo[3.1.0]hexan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 91012153 |
| Molecular Formula | C14H26O4Si |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (2S)-2-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxabicyclo[3.1.0]hexan-2-yl]propanoic acid |
| SMILES | C[C@H](C(=O)O)[C@@H]1[C@H]2O[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O4Si/c1-8(13(15)16)11-9(7-10-12(11)17-10)18-19(5,6)14(2,3)4/h8-12H,7H2,1-6H3,(H,15,16)/t8-,9+,10-,11-,12-/m0/s1 |
| InChIKey | ZGPABZZZLNBNFG-OSUNSFLBSA-N |
| XLogP | 2.88 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|