C25H28FN7O — CID 91016255
10-(5-fluorohepta-1,3,5-trien-2-yl)-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-5,6,9,10-tetrahydro-[1,2,4]triazolo[1,5-a]azocin-2-amine (PubChem CID 91016255) has the molecular formula C25H28FN7O and a molecular weight of 461.55 g/mol. Its IUPAC name is 10-(5-fluorohepta-1,3,5-trien-2-yl)-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-5,6,9,10-tetrahydro-[1,2,4]triazolo[1,5-a]azocin-2-amine.
| Compound Name | 10-(5-fluorohepta-1,3,5-trien-2-yl)-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-5,6,9,10-tetrahydro-[1,2,4]triazolo[1,5-a]azocin-2-amine |
|---|---|
| PubChem CID | 91016255 |
| Molecular Formula | C25H28FN7O |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 10-(5-fluorohepta-1,3,5-trien-2-yl)-N-[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]-5,6,9,10-tetrahydro-[1,2,4]triazolo[1,5-a]azocin-2-amine |
| SMILES | C=C(C=CC(F)=CC)C1CC=CCCn2nc(Nc3ccc(-n4cnc(C)n4)c(OC)c3)nc21 |
| InChI | InChI=1S/C25H28FN7O/c1-5-19(26)11-10-17(2)21-9-7-6-8-14-32-24(21)29-25(31-32)28-20-12-13-22(23(15-20)34-4)33-16-27-18(3)30-33/h5-7,10-13,15-16,21H,2,8-9,14H2,1,3-4H3,(H,28,31) |
| InChIKey | BRQZQHFTYPVNQI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|