C24H28F2N7+ — CID 91191136
N-[4-(2,3-dimethyl-1,2,4-triazol-2-ium-1-yl)-3-fluorophenyl]-9-(5-fluorohepta-1,3,5-trien-2-yl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine (PubChem CID 91191136) has the molecular formula C24H28F2N7+ and a molecular weight of 452.53 g/mol. Its IUPAC name is N-[4-(2,3-dimethyl-1,2,4-triazol-2-ium-1-yl)-3-fluorophenyl]-9-(5-fluorohepta-1,3,5-trien-2-yl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine.
| Compound Name | N-[4-(2,3-dimethyl-1,2,4-triazol-2-ium-1-yl)-3-fluorophenyl]-9-(5-fluorohepta-1,3,5-trien-2-yl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
|---|---|
| PubChem CID | 91191136 |
| Molecular Formula | C24H28F2N7+ |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | N-[4-(2,3-dimethyl-1,2,4-triazol-2-ium-1-yl)-3-fluorophenyl]-9-(5-fluorohepta-1,3,5-trien-2-yl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepin-2-amine |
| SMILES | C=C(C=CC(F)=CC)C1CCCCn2nc(Nc3ccc(-n4cnc(C)[n+]4C)c(F)c3)nc21 |
| InChI | InChI=1S/C24H28F2N7/c1-5-18(25)10-9-16(2)20-8-6-7-13-32-23(20)29-24(30-32)28-19-11-12-22(21(26)14-19)33-15-27-17(3)31(33)4/h5,9-12,14-15,20H,2,6-8,13H2,1,3-4H3,(H,28,30)/q+1 |
| InChIKey | RWLFGQOTANUQIE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|