C13H14N2O6 — CID 91027626
2-(2,5-dihydroxypyrrol-1-yl)-5-(2,5-dioxopyrrol-1-yl)pentanoic acid (PubChem CID 91027626) has the molecular formula C13H14N2O6 and a molecular weight of 294.26 g/mol. Its IUPAC name is 2-(2,5-dihydroxypyrrol-1-yl)-5-(2,5-dioxopyrrol-1-yl)pentanoic acid.
| Compound Name | 2-(2,5-dihydroxypyrrol-1-yl)-5-(2,5-dioxopyrrol-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 91027626 |
| Molecular Formula | C13H14N2O6 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-(2,5-dihydroxypyrrol-1-yl)-5-(2,5-dioxopyrrol-1-yl)pentanoic acid |
| SMILES | O=C(O)C(CCCN1C(=O)C=CC1=O)n1c(O)ccc1O |
| InChI | InChI=1S/C13H14N2O6/c16-9-3-4-10(17)14(9)7-1-2-8(13(20)21)15-11(18)5-6-12(15)19/h3-6,8,18-19H,1-2,7H2,(H,20,21) |
| InChIKey | ZSQWZWMOUYDBAP-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|