C25H35BrSi — CID 91027915
(5-bromo-2-methyl-2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-cyclopenta[a]naphthalen-3-yl)-(1H-inden-2-yl)-dimethylsilane (PubChem CID 91027915) has the molecular formula C25H35BrSi and a molecular weight of 443.55 g/mol. Its IUPAC name is (5-bromo-2-methyl-2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-cyclopenta[a]naphthalen-3-yl)-(1H-inden-2-yl)-dimethylsilane.
| Compound Name | (5-bromo-2-methyl-2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-cyclopenta[a]naphthalen-3-yl)-(1H-inden-2-yl)-dimethylsilane |
|---|---|
| PubChem CID | 91027915 |
| Molecular Formula | C25H35BrSi |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | (5-bromo-2-methyl-2,3,3a,4,5,5a,6,7,8,9,9a,9b-dodecahydro-1H-cyclopenta[a]naphthalen-3-yl)-(1H-inden-2-yl)-dimethylsilane |
| SMILES | CC1CC2C3CCCCC3C(Br)CC2C1[Si](C)(C)C1=Cc2ccccc2C1 |
| InChI | InChI=1S/C25H35BrSi/c1-16-12-22-20-10-6-7-11-21(20)24(26)15-23(22)25(16)27(2,3)19-13-17-8-4-5-9-18(17)14-19/h4-5,8-9,13,16,20-25H,6-7,10-12,14-15H2,1-3H3 |
| InChIKey | ZSMSFNZELBNHNC-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|