About N-(benzhydrylideneamino)methanamine;benzhydrylidenehydrazine
N-(benzhydrylideneamino)methanamine;benzhydrylidenehydrazine (PubChem CID 91030836) has the molecular formula C27H26N4
and a molecular weight of 406.53 g/mol. Its IUPAC name is N-(benzhydrylideneamino)methanamine;benzhydrylidenehydrazine.
Molecular Properties
| Compound Name | N-(benzhydrylideneamino)methanamine;benzhydrylidenehydrazine |
| PubChem CID | 91030836 |
| Molecular Formula | C27H26N4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | N-(benzhydrylideneamino)methanamine;benzhydrylidenehydrazine |
| SMILES | CNN=C(c1ccccc1)c1ccccc1.NN=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H14N2.C13H12N2/c1-15-16-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;14-15-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h2-11,15H,1H3;1-10H,14H2 |
| InChIKey | QKTVAASPWURCNH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(benzhydrylideneamino)methanamine;benzhydrylidenehydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(benzhydrylideneamino)methanamine;benzhydrylidenehydrazine?
The IUPAC name of N-(benzhydrylideneamino)methanamine;benzhydrylidenehydrazine (CID 91030836) is N-(benzhydrylideneamino)methanamine;benzhydrylidenehydrazine.
What is the SMILES notation for N-(benzhydrylideneamino)methanamine;benzhydrylidenehydrazine?
The canonical SMILES for N-(benzhydrylideneamino)methanamine;benzhydrylidenehydrazine is CNN=C(c1ccccc1)c1ccccc1.NN=C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(benzhydrylideneamino)methanamine;benzhydrylidenehydrazine?
The InChIKey is QKTVAASPWURCNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2.C13H12N2/c1-15-16-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;14-15-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h2-11,15H,1H3;1-10H,14H2.
What are the key properties of N-(benzhydrylideneamino)methanamine;benzhydrylidenehydrazine?
N-(benzhydrylideneamino)methanamine;benzhydrylidenehydrazine has a molecular weight of 406.53 g/mol, XLogP of 5.06, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(benzhydrylideneamino)methanamine;benzhydrylidenehydrazine is sourced from PubChem (CID 91030836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).