C12H18 — CID 91032346
6-ethyl-2-methyl-4,5,6,7-tetrahydro-3aH-indene (PubChem CID 91032346) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is 6-ethyl-2-methyl-4,5,6,7-tetrahydro-3aH-indene.
| Compound Name | 6-ethyl-2-methyl-4,5,6,7-tetrahydro-3aH-indene |
|---|---|
| PubChem CID | 91032346 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 6-ethyl-2-methyl-4,5,6,7-tetrahydro-3aH-indene |
| SMILES | CCC1CCC2C=C(C)C=C2C1 |
| InChI | InChI=1S/C12H18/c1-3-10-4-5-11-6-9(2)7-12(11)8-10/h6-7,10-11H,3-5,8H2,1-2H3 |
| InChIKey | XGOZMMIHRNPGEP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |