C10H16 — CID 87973123
1,5-diethyl-3-methylcyclopenta-1,3-diene (PubChem CID 87973123) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is 1,5-diethyl-3-methylcyclopenta-1,3-diene.
| Compound Name | 1,5-diethyl-3-methylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 87973123 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 1,5-diethyl-3-methylcyclopenta-1,3-diene |
| SMILES | CCC1=CC(C)=CC1CC |
| InChI | InChI=1S/C10H16/c1-4-9-6-8(3)7-10(9)5-2/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | ICDZBZQXTFENOA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |