C13H15NO4S — CID 91035227
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxy-propoxymethanethione (PubChem CID 91035227) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxy-propoxymethanethione.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxy-propoxymethanethione |
|---|---|
| PubChem CID | 91035227 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)oxy-propoxymethanethione |
| SMILES | CCCOC(=S)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C13H15NO4S/c1-2-5-17-13(19)18-14-11(15)9-7-3-4-8(6-7)10(9)12(14)16/h3-4,7-8,15-16H,2,5-6H2,1H3 |
| InChIKey | URELWUKPTKMHSL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|