C17H21FN4O6 — CID 91036990
(5R)-3-[3-tert-butyl-4-fluoro-2-(2-hydroxyethoxyimino)-1,3-benzoxazol-6-yl]-2-oxo-1,3-oxazolidine-5-carboxamide (PubChem CID 91036990) has the molecular formula C17H21FN4O6 and a molecular weight of 396.38 g/mol. Its IUPAC name is (5R)-3-[3-tert-butyl-4-fluoro-2-(2-hydroxyethoxyimino)-1,3-benzoxazol-6-yl]-2-oxo-1,3-oxazolidine-5-carboxamide.
| Compound Name | (5R)-3-[3-tert-butyl-4-fluoro-2-(2-hydroxyethoxyimino)-1,3-benzoxazol-6-yl]-2-oxo-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 91036990 |
| Molecular Formula | C17H21FN4O6 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (5R)-3-[3-tert-butyl-4-fluoro-2-(2-hydroxyethoxyimino)-1,3-benzoxazol-6-yl]-2-oxo-1,3-oxazolidine-5-carboxamide |
| SMILES | CC(C)(C)n1c(=NOCCO)oc2cc(N3C[C@H](C(N)=O)OC3=O)cc(F)c21 |
| InChI | InChI=1S/C17H21FN4O6/c1-17(2,3)22-13-10(18)6-9(21-8-12(14(19)24)28-16(21)25)7-11(13)27-15(22)20-26-5-4-23/h6-7,12,23H,4-5,8H2,1-3H3,(H2,19,24)/t12-/m1/s1 |
| InChIKey | JOTSINVDEFZDNQ-GFCCVEGCSA-N |
| XLogP | 0.76 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|