C26H33N2O2+ — CID 91038245
7-[4-(4-ethylcyclohexyl)phenyl]-N-propan-2-yl-2H-1,4-benzoxazin-4-ium-4-carboxamide (PubChem CID 91038245) has the molecular formula C26H33N2O2+ and a molecular weight of 405.56 g/mol. Its IUPAC name is 7-[4-(4-ethylcyclohexyl)phenyl]-N-propan-2-yl-2H-1,4-benzoxazin-4-ium-4-carboxamide.
| Compound Name | 7-[4-(4-ethylcyclohexyl)phenyl]-N-propan-2-yl-2H-1,4-benzoxazin-4-ium-4-carboxamide |
|---|---|
| PubChem CID | 91038245 |
| Molecular Formula | C26H33N2O2+ |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 7-[4-(4-ethylcyclohexyl)phenyl]-N-propan-2-yl-2H-1,4-benzoxazin-4-ium-4-carboxamide |
| SMILES | CCC1CCC(c2ccc(-c3ccc4c(c3)OCC=[N+]4C(=O)NC(C)C)cc2)CC1 |
| InChI | InChI=1S/C26H32N2O2/c1-4-19-5-7-20(8-6-19)21-9-11-22(12-10-21)23-13-14-24-25(17-23)30-16-15-28(24)26(29)27-18(2)3/h9-15,17-20H,4-8,16H2,1-3H3/p+1 |
| InChIKey | CAWNIIJDUZEGJL-UHFFFAOYSA-O |
| XLogP | 6.26 |
| TPSA | 41.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|