C28H40N4O4 — CID 91040807
N-(4-acetylphenyl)-5-aminopentanamide;3-amino-N-(7-oxooctyl)benzamide (PubChem CID 91040807) has the molecular formula C28H40N4O4 and a molecular weight of 496.65 g/mol. Its IUPAC name is N-(4-acetylphenyl)-5-aminopentanamide;3-amino-N-(7-oxooctyl)benzamide.
| Compound Name | N-(4-acetylphenyl)-5-aminopentanamide;3-amino-N-(7-oxooctyl)benzamide |
|---|---|
| PubChem CID | 91040807 |
| Molecular Formula | C28H40N4O4 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | N-(4-acetylphenyl)-5-aminopentanamide;3-amino-N-(7-oxooctyl)benzamide |
| SMILES | CC(=O)CCCCCCNC(=O)c1cccc(N)c1.CC(=O)c1ccc(NC(=O)CCCCN)cc1 |
| InChI | InChI=1S/C15H22N2O2.C13H18N2O2/c1-12(18)7-4-2-3-5-10-17-15(19)13-8-6-9-14(16)11-13;1-10(16)11-5-7-12(8-6-11)15-13(17)4-2-3-9-14/h6,8-9,11H,2-5,7,10,16H2,1H3,(H,17,19);5-8H,2-4,9,14H2,1H3,(H,15,17) |
| InChIKey | AWMATGIJPKYUHU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|