C23H18FNO4S — CID 91040855
(2,5-dihydroxypyrrol-1-yl) 2-[6-fluoro-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]acetate (PubChem CID 91040855) has the molecular formula C23H18FNO4S and a molecular weight of 423.47 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[6-fluoro-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[6-fluoro-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]acetate |
|---|---|
| PubChem CID | 91040855 |
| Molecular Formula | C23H18FNO4S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[6-fluoro-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]acetate |
| SMILES | CSc1ccc(C=C2C=C(CC(=O)On3c(O)ccc3O)c3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C23H18FNO4S/c1-30-18-5-2-14(3-6-18)10-15-11-16(20-13-17(24)4-7-19(15)20)12-23(28)29-25-21(26)8-9-22(25)27/h2-11,13,26-27H,12H2,1H3 |
| InChIKey | NGKCYIKVXPHLNY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|