C10H9N3O2S2 — CID 91046069
1-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)-1-phenylurea (PubChem CID 91046069) has the molecular formula C10H9N3O2S2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)-1-phenylurea.
| Compound Name | 1-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)-1-phenylurea |
|---|---|
| PubChem CID | 91046069 |
| Molecular Formula | C10H9N3O2S2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 1-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)-1-phenylurea |
| SMILES | NC(=O)N(c1ccccc1)n1c(O)csc1=S |
| InChI | InChI=1S/C10H9N3O2S2/c11-9(15)12(7-4-2-1-3-5-7)13-8(14)6-17-10(13)16/h1-6,14H,(H2,11,15) |
| InChIKey | BHWDPJWZQQTMTE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|