C12H15F8NO — CID 91047662
2-ethyl-N-(3,3,4,4,5,5,6,6-octafluorohexyl)but-2-enamide (PubChem CID 91047662) has the molecular formula C12H15F8NO and a molecular weight of 341.24 g/mol. Its IUPAC name is 2-ethyl-N-(3,3,4,4,5,5,6,6-octafluorohexyl)but-2-enamide.
| Compound Name | 2-ethyl-N-(3,3,4,4,5,5,6,6-octafluorohexyl)but-2-enamide |
|---|---|
| PubChem CID | 91047662 |
| Molecular Formula | C12H15F8NO |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-ethyl-N-(3,3,4,4,5,5,6,6-octafluorohexyl)but-2-enamide |
| SMILES | CC=C(CC)C(=O)NCCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H15F8NO/c1-3-7(4-2)8(22)21-6-5-10(15,16)12(19,20)11(17,18)9(13)14/h3,9H,4-6H2,1-2H3,(H,21,22) |
| InChIKey | IEZJLTRQTKGZTR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|