About ethane;methylsulfonylmethane;trichloro(3-phenylpropyl)silane
ethane;methylsulfonylmethane;trichloro(3-phenylpropyl)silane (PubChem CID 91053688) has the molecular formula C13H23Cl3O2SSi
and a molecular weight of 377.84 g/mol. Its IUPAC name is ethane;methylsulfonylmethane;trichloro(3-phenylpropyl)silane.
Molecular Properties
| Compound Name | ethane;methylsulfonylmethane;trichloro(3-phenylpropyl)silane |
| PubChem CID | 91053688 |
| Molecular Formula | C13H23Cl3O2SSi |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | ethane;methylsulfonylmethane;trichloro(3-phenylpropyl)silane |
| SMILES | CC.CS(C)(=O)=O.Cl[Si](Cl)(Cl)CCCc1ccccc1 |
| InChI | InChI=1S/C9H11Cl3Si.C2H6O2S.C2H6/c10-13(11,12)8-4-7-9-5-2-1-3-6-9;1-5(2,3)4;1-2/h1-3,5-6H,4,7-8H2;1-2H3;1-2H3 |
| InChIKey | GPTSNLFBTPCBOZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze ethane;methylsulfonylmethane;trichloro(3-phenylpropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methylsulfonylmethane;trichloro(3-phenylpropyl)silane?
The IUPAC name of ethane;methylsulfonylmethane;trichloro(3-phenylpropyl)silane (CID 91053688) is ethane;methylsulfonylmethane;trichloro(3-phenylpropyl)silane.
What is the SMILES notation for ethane;methylsulfonylmethane;trichloro(3-phenylpropyl)silane?
The canonical SMILES for ethane;methylsulfonylmethane;trichloro(3-phenylpropyl)silane is CC.CS(C)(=O)=O.Cl[Si](Cl)(Cl)CCCc1ccccc1.
What is the InChIKey of ethane;methylsulfonylmethane;trichloro(3-phenylpropyl)silane?
The InChIKey is GPTSNLFBTPCBOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Cl3Si.C2H6O2S.C2H6/c10-13(11,12)8-4-7-9-5-2-1-3-6-9;1-5(2,3)4;1-2/h1-3,5-6H,4,7-8H2;1-2H3;1-2H3.
What are the key properties of ethane;methylsulfonylmethane;trichloro(3-phenylpropyl)silane?
ethane;methylsulfonylmethane;trichloro(3-phenylpropyl)silane has a molecular weight of 377.84 g/mol, XLogP of 4.96, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methylsulfonylmethane;trichloro(3-phenylpropyl)silane is sourced from PubChem (CID 91053688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).