C35H48F3N7O2 — CID 91055585
N-[2-(aminodiazenyl)-2-iminoethyl]-4-[4,4-dimethyl-1-[2-methyl-5-oxo-4-[3-(trifluoromethyl)phenyl]-2-(3,4,4-trimethylpentyl)imidazol-1-yl]pentyl]benzamide (PubChem CID 91055585) has the molecular formula C35H48F3N7O2 and a molecular weight of 655.81 g/mol. Its IUPAC name is N-[2-(aminodiazenyl)-2-iminoethyl]-4-[4,4-dimethyl-1-[2-methyl-5-oxo-4-[3-(trifluoromethyl)phenyl]-2-(3,4,4-trimethylpentyl)imidazol-1-yl]pentyl]benzamide.
| Compound Name | N-[2-(aminodiazenyl)-2-iminoethyl]-4-[4,4-dimethyl-1-[2-methyl-5-oxo-4-[3-(trifluoromethyl)phenyl]-2-(3,4,4-trimethylpentyl)imidazol-1-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 91055585 |
| Molecular Formula | C35H48F3N7O2 |
| Molecular Weight | 655.81 g/mol |
| Exact Mass | 655.38 |
| IUPAC Name | N-[2-(aminodiazenyl)-2-iminoethyl]-4-[4,4-dimethyl-1-[2-methyl-5-oxo-4-[3-(trifluoromethyl)phenyl]-2-(3,4,4-trimethylpentyl)imidazol-1-yl]pentyl]benzamide |
| SMILES | [H]/N=C(CNC(=O)c1ccc(C(CCC(C)(C)C)N2C(=O)C(c3cccc(C(F)(F)F)c3)=NC2(C)CCC(C)C(C)(C)C)cc1)\N=N\N |
| InChI | InChI=1S/C35H48F3N7O2/c1-22(33(5,6)7)16-19-34(8)42-29(25-10-9-11-26(20-25)35(36,37)38)31(47)45(34)27(17-18-32(2,3)4)23-12-14-24(15-13-23)30(46)41-21-28(39)43-44-40/h9-15,20,22,27H,16-19,21H2,1-8H3,(H,41,46)(H3,39,40,43) |
| InChIKey | ILPACXUMAOYXCL-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.81 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|