C22H27FO3S — CID 91056779
1-[4-[4-(3-fluorophenyl)sulfanylbutoxy]-2-hydroxy-3-methylphenyl]-3-methylbutan-2-one (PubChem CID 91056779) has the molecular formula C22H27FO3S and a molecular weight of 390.52 g/mol. Its IUPAC name is 1-[4-[4-(3-fluorophenyl)sulfanylbutoxy]-2-hydroxy-3-methylphenyl]-3-methylbutan-2-one.
| Compound Name | 1-[4-[4-(3-fluorophenyl)sulfanylbutoxy]-2-hydroxy-3-methylphenyl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 91056779 |
| Molecular Formula | C22H27FO3S |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[4-[4-(3-fluorophenyl)sulfanylbutoxy]-2-hydroxy-3-methylphenyl]-3-methylbutan-2-one |
| SMILES | Cc1c(OCCCCSc2cccc(F)c2)ccc(CC(=O)C(C)C)c1O |
| InChI | InChI=1S/C22H27FO3S/c1-15(2)20(24)13-17-9-10-21(16(3)22(17)25)26-11-4-5-12-27-19-8-6-7-18(23)14-19/h6-10,14-15,25H,4-5,11-13H2,1-3H3 |
| InChIKey | MNHJOQABIFLXLA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|