C22H24F4O3S — CID 87814974
4-[2-hydroxy-3-methyl-4-[4-(2,3,5,6-tetrafluorophenyl)sulfanylbutoxy]phenyl]-3-methylbutan-2-one (PubChem CID 87814974) has the molecular formula C22H24F4O3S and a molecular weight of 444.49 g/mol. Its IUPAC name is 4-[2-hydroxy-3-methyl-4-[4-(2,3,5,6-tetrafluorophenyl)sulfanylbutoxy]phenyl]-3-methylbutan-2-one.
| Compound Name | 4-[2-hydroxy-3-methyl-4-[4-(2,3,5,6-tetrafluorophenyl)sulfanylbutoxy]phenyl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 87814974 |
| Molecular Formula | C22H24F4O3S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 4-[2-hydroxy-3-methyl-4-[4-(2,3,5,6-tetrafluorophenyl)sulfanylbutoxy]phenyl]-3-methylbutan-2-one |
| SMILES | CC(=O)C(C)Cc1ccc(OCCCCSc2c(F)c(F)cc(F)c2F)c(C)c1O |
| InChI | InChI=1S/C22H24F4O3S/c1-12(14(3)27)10-15-6-7-18(13(2)21(15)28)29-8-4-5-9-30-22-19(25)16(23)11-17(24)20(22)26/h6-7,11-12,28H,4-5,8-10H2,1-3H3 |
| InChIKey | FTTSDAYPPJAHJM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|