C14H18N3O2P — CID 91058724
3-[2-(ethylamino)ethyl]-5-methylidenephosphanyl-5-phenylimidazolidine-2,4-dione (PubChem CID 91058724) has the molecular formula C14H18N3O2P and a molecular weight of 291.29 g/mol. Its IUPAC name is 3-[2-(ethylamino)ethyl]-5-methylidenephosphanyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(ethylamino)ethyl]-5-methylidenephosphanyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91058724 |
| Molecular Formula | C14H18N3O2P |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-[2-(ethylamino)ethyl]-5-methylidenephosphanyl-5-phenylimidazolidine-2,4-dione |
| SMILES | C=PC1(c2ccccc2)NC(=O)N(CCNCC)C1=O |
| InChI | InChI=1S/C14H18N3O2P/c1-3-15-9-10-17-12(18)14(20-2,16-13(17)19)11-7-5-4-6-8-11/h4-8,15H,2-3,9-10H2,1H3,(H,16,19) |
| InChIKey | NDPZVSXOTOTOJX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|