C30H39ClN6O4 — CID 91059012
2-amino-N',N'-bis(2-aminoethyl)-N-[1-[4-(2-chlorophenoxy)anilino]-1-hydroxy-4-phenylbutan-2-yl]butanediamide (PubChem CID 91059012) has the molecular formula C30H39ClN6O4 and a molecular weight of 583.13 g/mol. Its IUPAC name is 2-amino-N',N'-bis(2-aminoethyl)-N-[1-[4-(2-chlorophenoxy)anilino]-1-hydroxy-4-phenylbutan-2-yl]butanediamide.
| Compound Name | 2-amino-N',N'-bis(2-aminoethyl)-N-[1-[4-(2-chlorophenoxy)anilino]-1-hydroxy-4-phenylbutan-2-yl]butanediamide |
|---|---|
| PubChem CID | 91059012 |
| Molecular Formula | C30H39ClN6O4 |
| Molecular Weight | 583.13 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | 2-amino-N',N'-bis(2-aminoethyl)-N-[1-[4-(2-chlorophenoxy)anilino]-1-hydroxy-4-phenylbutan-2-yl]butanediamide |
| SMILES | NCCN(CCN)C(=O)CC(N)C(=O)NC(CCc1ccccc1)C(O)Nc1ccc(Oc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C30H39ClN6O4/c31-24-8-4-5-9-27(24)41-23-13-11-22(12-14-23)35-30(40)26(15-10-21-6-2-1-3-7-21)36-29(39)25(34)20-28(38)37(18-16-32)19-17-33/h1-9,11-14,25-26,30,35,40H,10,15-20,32-34H2,(H,36,39) |
| InChIKey | HWSQGDWCARLHSB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 168.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.13 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|