C53H51N5O9 — CID 91061153
4-[10,15,20-tris(2,4,6-trimethoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]aniline (PubChem CID 91061153) has the molecular formula C53H51N5O9 and a molecular weight of 902.02 g/mol. Its IUPAC name is 4-[10,15,20-tris(2,4,6-trimethoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]aniline.
| Compound Name | 4-[10,15,20-tris(2,4,6-trimethoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]aniline |
|---|---|
| PubChem CID | 91061153 |
| Molecular Formula | C53H51N5O9 |
| Molecular Weight | 902.02 g/mol |
| Exact Mass | 901.37 |
| IUPAC Name | 4-[10,15,20-tris(2,4,6-trimethoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]aniline |
| SMILES | COc1cc(OC)c(C2=c3ccc([nH]3)=C(c3ccc(N)cc3)c3ccc([nH]3)C(c3c(OC)cc(OC)cc3OC)=c3ccc([nH]3)=C(c3c(OC)cc(OC)cc3OC)c3ccc2[nH]3)c(OC)c1 |
| InChI | InChI=1S/C53H51N5O9/c1-59-30-22-41(62-4)51(42(23-30)63-5)48-35-16-14-33(55-35)47(28-10-12-29(54)13-11-28)34-15-17-36(56-34)49(52-43(64-6)24-31(60-2)25-44(52)65-7)38-19-21-40(58-38)50(39-20-18-37(48)57-39)53-45(66-8)26-32(61-3)27-46(53)67-9/h10-27,55-58H,54H2,1-9H3 |
| InChIKey | IZHJJTGWPHDCOH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 172.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.02 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|