C18H31NO2S — CID 91061204
4-ethenyl-6-(2-propylpentylsulfonyl)octa-2,4,6-trien-1-amine (PubChem CID 91061204) has the molecular formula C18H31NO2S and a molecular weight of 325.52 g/mol. Its IUPAC name is 4-ethenyl-6-(2-propylpentylsulfonyl)octa-2,4,6-trien-1-amine.
| Compound Name | 4-ethenyl-6-(2-propylpentylsulfonyl)octa-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 91061204 |
| Molecular Formula | C18H31NO2S |
| Molecular Weight | 325.52 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | 4-ethenyl-6-(2-propylpentylsulfonyl)octa-2,4,6-trien-1-amine |
| SMILES | C=CC(C=CCN)=CC(=CC)S(=O)(=O)CC(CCC)CCC |
| InChI | InChI=1S/C18H31NO2S/c1-5-10-17(11-6-2)15-22(20,21)18(8-4)14-16(7-3)12-9-13-19/h7-9,12,14,17H,3,5-6,10-11,13,15,19H2,1-2,4H3 |
| InChIKey | MSKSMXHTFCTUDS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|